CAS NO: 57116-45-7
Specification: Solid content 99%Min
| Product Name | Pentaerythritol tris[3-(1-aziridinyl)propionate] |
| Quality Standard | Solid content 99.0%Min |
| Synonyms | Apa-1 Pentaerythritol-tris-(beta-n-aziridinyl)propionate Tazo, xama 7, Pentaerythritol tris(3-aziridin-1-ylpropionate) |
| Structure | ![]() |
| SMILES | O=C(CCN1CC1)OCC(CO)(COC(=O)CCN2CC2)COC(=O)CCN3CC3 |
| Appearance | Colorless to light yellow liquid |
| Solid content(w/w) | 99%Min |
| Viscosity (25°C) | 1000-4000cp |
| PH (25°C) | 8.0-11.0 |
| Density (20°C) | 1.18-1.20KG/L |
| aziridinyl | 6.74 mol/KG |
| Hydroxyl | 2.34 mol/KG |
| Freezing point | ≤-10°C |
| Solubility | be soluble in water, alcohol, ketone and ester |
| Packing | 25KG net plastic liner iron drum |



